C15H14N4O — CID 162626496
3-imidazo[1,2-a]pyrazin-3-yl-N,N-dimethylbenzamide (PubChem CID 162626496) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyrazin-3-yl-N,N-dimethylbenzamide.
| Compound Name | 3-imidazo[1,2-a]pyrazin-3-yl-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 162626496 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-imidazo[1,2-a]pyrazin-3-yl-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(-c2cnc3cnccn23)c1 |
| InChI | InChI=1S/C15H14N4O/c1-18(2)15(20)12-5-3-4-11(8-12)13-9-17-14-10-16-6-7-19(13)14/h3-10H,1-2H3 |
| InChIKey | JHWIAHVKPICJBP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |