C13H11N3O — CID 157018746
3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine (PubChem CID 157018746) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine.
| Compound Name | 3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 157018746 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine |
| SMILES | COc1ccc(-c2cnc3cnccn23)cc1 |
| InChI | InChI=1S/C13H11N3O/c1-17-11-4-2-10(3-5-11)12-8-15-13-9-14-6-7-16(12)13/h2-9H,1H3 |
| InChIKey | ZZWNBNXSPWQUJH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |