C13H11N3O2S — CID 157020249
3-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazine (PubChem CID 157020249) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazine.
| Compound Name | 3-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 157020249 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazine |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc3cnccn23)cc1 |
| InChI | InChI=1S/C13H11N3O2S/c1-19(17,18)11-4-2-10(3-5-11)12-8-15-13-9-14-6-7-16(12)13/h2-9H,1H3 |
| InChIKey | OHOOTOUOOWWWEJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |