C13H11N3O — CID 157019835
(4-imidazo[1,2-a]pyrazin-3-ylphenyl)methanol (PubChem CID 157019835) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is (4-imidazo[1,2-a]pyrazin-3-ylphenyl)methanol.
| Compound Name | (4-imidazo[1,2-a]pyrazin-3-ylphenyl)methanol |
|---|---|
| PubChem CID | 157019835 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (4-imidazo[1,2-a]pyrazin-3-ylphenyl)methanol |
| SMILES | OCc1ccc(-c2cnc3cnccn23)cc1 |
| InChI | InChI=1S/C13H11N3O/c17-9-10-1-3-11(4-2-10)12-7-15-13-8-14-5-6-16(12)13/h1-8,17H,9H2 |
| InChIKey | JXRQVDOUUCRLCD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |