C11H7N3O2S — CID 82385228
3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid (PubChem CID 82385228) has the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid.
| Compound Name | 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 82385228 |
| Molecular Formula | C11H7N3O2S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1-c1cnc2cnccn12 |
| InChI | InChI=1S/C11H7N3O2S/c15-11(16)10-7(1-4-17-10)8-5-13-9-6-12-2-3-14(8)9/h1-6H,(H,15,16) |
| InChIKey | BLDJPLPHLVVKES-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |