3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid

C11H7N3O2S — CID 82385228

IUPAC3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid
SMILESO=C(O)c1sccc1-c1cnc2cnccn12
InChIInChI=1S/C11H7N3O2S/c15-11(16)10-7(1-4-17-10)8-5-13-9-6-12-2-3-14(8)9/h1-6H,(H,15,16)
InChIKeyBLDJPLPHLVVKES-UHFFFAOYSA-N
MW245.26 g/mol
LogP2.16
Rot. Bonds2

About 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid

3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid (PubChem CID 82385228) has the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid.

Molecular Properties

Compound Name3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid
PubChem CID82385228
Molecular FormulaC11H7N3O2S
Molecular Weight245.26 g/mol
Exact Mass245.03
IUPAC Name3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid
SMILESO=C(O)c1sccc1-c1cnc2cnccn12
InChIInChI=1S/C11H7N3O2S/c15-11(16)10-7(1-4-17-10)8-5-13-9-6-12-2-3-14(8)9/h1-6H,(H,15,16)
InChIKeyBLDJPLPHLVVKES-UHFFFAOYSA-N
XLogP2.16
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.26
LogP ≤ 52.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid?
The IUPAC name of 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid (CID 82385228) is 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid.
What is the SMILES notation for 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid?
The canonical SMILES for 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid is O=C(O)c1sccc1-c1cnc2cnccn12.
What is the InChIKey of 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid?
The InChIKey is BLDJPLPHLVVKES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O2S/c15-11(16)10-7(1-4-17-10)8-5-13-9-6-12-2-3-14(8)9/h1-6H,(H,15,16).
What are the key properties of 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid?
3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid has a molecular weight of 245.26 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[1,2-a]pyrazin-3-ylthiophene-2-carboxylic acid is sourced from PubChem (CID 82385228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).