C15H13FN4O — CID 165375334
4-(6-fluoro-5-imidazo[1,2-a]pyrazin-3-yl-2-pyridinyl)butan-2-one (PubChem CID 165375334) has the molecular formula C15H13FN4O and a molecular weight of 284.29 g/mol. Its IUPAC name is 4-(6-fluoro-5-imidazo[1,2-a]pyrazin-3-yl-2-pyridinyl)butan-2-one.
| Compound Name | 4-(6-fluoro-5-imidazo[1,2-a]pyrazin-3-yl-2-pyridinyl)butan-2-one |
|---|---|
| PubChem CID | 165375334 |
| Molecular Formula | C15H13FN4O |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-(6-fluoro-5-imidazo[1,2-a]pyrazin-3-yl-2-pyridinyl)butan-2-one |
| SMILES | CC(=O)CCc1ccc(-c2cnc3cnccn23)c(F)n1 |
| InChI | InChI=1S/C15H13FN4O/c1-10(21)2-3-11-4-5-12(15(16)19-11)13-8-18-14-9-17-6-7-20(13)14/h4-9H,2-3H2,1H3 |
| InChIKey | ANQKPMNKLKBIJU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|