C14H14N4 — CID 157012293
2-imidazo[1,2-a]pyrazin-3-yl-N,N-dimethylaniline (PubChem CID 157012293) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyrazin-3-yl-N,N-dimethylaniline.
| Compound Name | 2-imidazo[1,2-a]pyrazin-3-yl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 157012293 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-imidazo[1,2-a]pyrazin-3-yl-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1-c1cnc2cnccn12 |
| InChI | InChI=1S/C14H14N4/c1-17(2)12-6-4-3-5-11(12)13-9-16-14-10-15-7-8-18(13)14/h3-10H,1-2H3 |
| InChIKey | QBORFXYXABNZDZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |