(4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid

C12H10BN3O2 — CID 141396507

IUPAC(4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid
SMILESOB(O)c1ccc(-c2cnc3cnccn23)cc1
InChIInChI=1S/C12H10BN3O2/c17-13(18)10-3-1-9(2-4-10)11-7-15-12-8-14-5-6-16(11)12/h1-8,17-18H
InChIKeyCIUVRMFBWMEEQW-UHFFFAOYSA-N
MW239.04 g/mol
LogP0.08
Rot. Bonds2

About (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid

(4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid (PubChem CID 141396507) has the molecular formula C12H10BN3O2 and a molecular weight of 239.04 g/mol. Its IUPAC name is (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid.

Molecular Properties

Compound Name(4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid
PubChem CID141396507
Molecular FormulaC12H10BN3O2
Molecular Weight239.04 g/mol
Exact Mass239.09
IUPAC Name(4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid
SMILESOB(O)c1ccc(-c2cnc3cnccn23)cc1
InChIInChI=1S/C12H10BN3O2/c17-13(18)10-3-1-9(2-4-10)11-7-15-12-8-14-5-6-16(11)12/h1-8,17-18H
InChIKeyCIUVRMFBWMEEQW-UHFFFAOYSA-N
XLogP0.08
TPSA70.65 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.04
LogP ≤ 50.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid?
The IUPAC name of (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid (CID 141396507) is (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid.
What is the SMILES notation for (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid?
The canonical SMILES for (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid is OB(O)c1ccc(-c2cnc3cnccn23)cc1.
What is the InChIKey of (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid?
The InChIKey is CIUVRMFBWMEEQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BN3O2/c17-13(18)10-3-1-9(2-4-10)11-7-15-12-8-14-5-6-16(11)12/h1-8,17-18H.
What are the key properties of (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid?
(4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid has a molecular weight of 239.04 g/mol, XLogP of 0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid is sourced from PubChem (CID 141396507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).