C12H10BN3O2 — CID 141396507
(4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid (PubChem CID 141396507) has the molecular formula C12H10BN3O2 and a molecular weight of 239.04 g/mol. Its IUPAC name is (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid.
| Compound Name | (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid |
|---|---|
| PubChem CID | 141396507 |
| Molecular Formula | C12H10BN3O2 |
| Molecular Weight | 239.04 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (4-imidazo[1,2-a]pyrazin-3-ylphenyl)boronic acid |
| SMILES | OB(O)c1ccc(-c2cnc3cnccn23)cc1 |
| InChI | InChI=1S/C12H10BN3O2/c17-13(18)10-3-1-9(2-4-10)11-7-15-12-8-14-5-6-16(11)12/h1-8,17-18H |
| InChIKey | CIUVRMFBWMEEQW-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.04 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|