C15H15N3O — CID 163318481
3-[4-(1-methoxyethyl)phenyl]imidazo[1,2-a]pyrazine (PubChem CID 163318481) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 3-[4-(1-methoxyethyl)phenyl]imidazo[1,2-a]pyrazine.
| Compound Name | 3-[4-(1-methoxyethyl)phenyl]imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 163318481 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-[4-(1-methoxyethyl)phenyl]imidazo[1,2-a]pyrazine |
| SMILES | COC(C)c1ccc(-c2cnc3cnccn23)cc1 |
| InChI | InChI=1S/C15H15N3O/c1-11(19-2)12-3-5-13(6-4-12)14-9-17-15-10-16-7-8-18(14)15/h3-11H,1-2H3 |
| InChIKey | JFLREZPPYLNREX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |