C20H24FN3O5S — CID 172632050
2-[3-(3-amino-5-fluoro-4-methoxyphenyl)-5-tert-butylsulfonylpyrazolo[1,5-a]pyridin-6-yl]oxyethanol (PubChem CID 172632050) has the molecular formula C20H24FN3O5S and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-[3-(3-amino-5-fluoro-4-methoxyphenyl)-5-tert-butylsulfonylpyrazolo[1,5-a]pyridin-6-yl]oxyethanol.
| Compound Name | 2-[3-(3-amino-5-fluoro-4-methoxyphenyl)-5-tert-butylsulfonylpyrazolo[1,5-a]pyridin-6-yl]oxyethanol |
|---|---|
| PubChem CID | 172632050 |
| Molecular Formula | C20H24FN3O5S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[3-(3-amino-5-fluoro-4-methoxyphenyl)-5-tert-butylsulfonylpyrazolo[1,5-a]pyridin-6-yl]oxyethanol |
| SMILES | COc1c(N)cc(-c2cnn3cc(OCCO)c(S(=O)(=O)C(C)(C)C)cc23)cc1F |
| InChI | InChI=1S/C20H24FN3O5S/c1-20(2,3)30(26,27)18-9-16-13(10-23-24(16)11-17(18)29-6-5-25)12-7-14(21)19(28-4)15(22)8-12/h7-11,25H,5-6,22H2,1-4H3 |
| InChIKey | OWVVCIFZKBROAN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|