C24H21ClN2O4 — CID 172633038
3-[[5-chloro-2-oxo-3-(4-propan-2-yloxyphenyl)benzimidazol-1-yl]methyl]benzoic acid (PubChem CID 172633038) has the molecular formula C24H21ClN2O4 and a molecular weight of 436.90 g/mol. Its IUPAC name is 3-[[5-chloro-2-oxo-3-(4-propan-2-yloxyphenyl)benzimidazol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[5-chloro-2-oxo-3-(4-propan-2-yloxyphenyl)benzimidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 172633038 |
| Molecular Formula | C24H21ClN2O4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 3-[[5-chloro-2-oxo-3-(4-propan-2-yloxyphenyl)benzimidazol-1-yl]methyl]benzoic acid |
| SMILES | CC(C)Oc1ccc(-n2c(=O)n(Cc3cccc(C(=O)O)c3)c3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C24H21ClN2O4/c1-15(2)31-20-9-7-19(8-10-20)27-22-13-18(25)6-11-21(22)26(24(27)30)14-16-4-3-5-17(12-16)23(28)29/h3-13,15H,14H2,1-2H3,(H,28,29) |
| InChIKey | ZWOMVIATJHZYLW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |