C28H21ClN2O3 — CID 172633091
methyl 3-[[5-chloro-2-oxo-3-(4-phenylphenyl)benzimidazol-1-yl]methyl]benzoate (PubChem CID 172633091) has the molecular formula C28H21ClN2O3 and a molecular weight of 468.94 g/mol. Its IUPAC name is methyl 3-[[5-chloro-2-oxo-3-(4-phenylphenyl)benzimidazol-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[5-chloro-2-oxo-3-(4-phenylphenyl)benzimidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 172633091 |
| Molecular Formula | C28H21ClN2O3 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | methyl 3-[[5-chloro-2-oxo-3-(4-phenylphenyl)benzimidazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(Cn2c(=O)n(-c3ccc(-c4ccccc4)cc3)c3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C28H21ClN2O3/c1-34-27(32)22-9-5-6-19(16-22)18-30-25-15-12-23(29)17-26(25)31(28(30)33)24-13-10-21(11-14-24)20-7-3-2-4-8-20/h2-17H,18H2,1H3 |
| InChIKey | ANHHDEURXJAOAQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |