C26H24ClFN4O3 — CID 172632946
methyl 3-[[5-chloro-2-oxo-3-(4-piperazin-1-ylphenyl)benzimidazol-1-yl]methyl]-2-fluorobenzoate (PubChem CID 172632946) has the molecular formula C26H24ClFN4O3 and a molecular weight of 494.95 g/mol. Its IUPAC name is methyl 3-[[5-chloro-2-oxo-3-(4-piperazin-1-ylphenyl)benzimidazol-1-yl]methyl]-2-fluorobenzoate.
| Compound Name | methyl 3-[[5-chloro-2-oxo-3-(4-piperazin-1-ylphenyl)benzimidazol-1-yl]methyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 172632946 |
| Molecular Formula | C26H24ClFN4O3 |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | methyl 3-[[5-chloro-2-oxo-3-(4-piperazin-1-ylphenyl)benzimidazol-1-yl]methyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1cccc(Cn2c(=O)n(-c3ccc(N4CCNCC4)cc3)c3cc(Cl)ccc32)c1F |
| InChI | InChI=1S/C26H24ClFN4O3/c1-35-25(33)21-4-2-3-17(24(21)28)16-31-22-10-5-18(27)15-23(22)32(26(31)34)20-8-6-19(7-9-20)30-13-11-29-12-14-30/h2-10,15,29H,11-14,16H2,1H3 |
| InChIKey | HTNVEISZWMHLMQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|