C25H20ClF2N3O4 — CID 172633182
3-[[5-chloro-4-fluoro-3-(4-morpholin-4-ylphenyl)-2-oxobenzimidazol-1-yl]methyl]-2-fluorobenzoic acid (PubChem CID 172633182) has the molecular formula C25H20ClF2N3O4 and a molecular weight of 499.90 g/mol. Its IUPAC name is 3-[[5-chloro-4-fluoro-3-(4-morpholin-4-ylphenyl)-2-oxobenzimidazol-1-yl]methyl]-2-fluorobenzoic acid.
| Compound Name | 3-[[5-chloro-4-fluoro-3-(4-morpholin-4-ylphenyl)-2-oxobenzimidazol-1-yl]methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 172633182 |
| Molecular Formula | C25H20ClF2N3O4 |
| Molecular Weight | 499.90 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 3-[[5-chloro-4-fluoro-3-(4-morpholin-4-ylphenyl)-2-oxobenzimidazol-1-yl]methyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cccc(Cn2c(=O)n(-c3ccc(N4CCOCC4)cc3)c3c(F)c(Cl)ccc32)c1F |
| InChI | InChI=1S/C25H20ClF2N3O4/c26-19-8-9-20-23(22(19)28)31(17-6-4-16(5-7-17)29-10-12-35-13-11-29)25(34)30(20)14-15-2-1-3-18(21(15)27)24(32)33/h1-9H,10-14H2,(H,32,33) |
| InChIKey | VBSLTKNJOJUGBI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.90 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|