C20H26FN3O — CID 172633624
(3S)-N-[4-cyclobutyl-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]-3-methylpentanamide (PubChem CID 172633624) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is (3S)-N-[4-cyclobutyl-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]-3-methylpentanamide.
| Compound Name | (3S)-N-[4-cyclobutyl-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 172633624 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (3S)-N-[4-cyclobutyl-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]-3-methylpentanamide |
| SMILES | CC[C@H](C)CC(=O)Nc1nn(C)c(-c2ccc(F)cc2)c1C1CCC1 |
| InChI | InChI=1S/C20H26FN3O/c1-4-13(2)12-17(25)22-20-18(14-6-5-7-14)19(24(3)23-20)15-8-10-16(21)11-9-15/h8-11,13-14H,4-7,12H2,1-3H3,(H,22,23,25)/t13-/m0/s1 |
| InChIKey | IFECYXAMJCGZPJ-ZDUSSCGKSA-N |
| XLogP | 4.87 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |