C20H19F6N3O — CID 172633521
N-[4-cyclobutyl-5-(3,4-difluorophenyl)-1-methylpyrazol-3-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide (PubChem CID 172633521) has the molecular formula C20H19F6N3O and a molecular weight of 431.38 g/mol. Its IUPAC name is N-[4-cyclobutyl-5-(3,4-difluorophenyl)-1-methylpyrazol-3-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide.
| Compound Name | N-[4-cyclobutyl-5-(3,4-difluorophenyl)-1-methylpyrazol-3-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
|---|---|
| PubChem CID | 172633521 |
| Molecular Formula | C20H19F6N3O |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[4-cyclobutyl-5-(3,4-difluorophenyl)-1-methylpyrazol-3-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
| SMILES | Cn1nc(NC(=O)C[C@@H]2CC(F)(F)C2(F)F)c(C2CCC2)c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H19F6N3O/c1-29-17(11-5-6-13(21)14(22)7-11)16(10-3-2-4-10)18(28-29)27-15(30)8-12-9-19(23,24)20(12,25)26/h5-7,10,12H,2-4,8-9H2,1H3,(H,27,28,30)/t12-/m1/s1 |
| InChIKey | YAOVDPXLQCCURU-GFCCVEGCSA-N |
| XLogP | 5.25 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|