C19H25F4N3O — CID 172633731
N-[4-cyclobutyl-3-(cyclobutylmethyl)-1-methylpyrazol-5-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide (PubChem CID 172633731) has the molecular formula C19H25F4N3O and a molecular weight of 387.42 g/mol. Its IUPAC name is N-[4-cyclobutyl-3-(cyclobutylmethyl)-1-methylpyrazol-5-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide.
| Compound Name | N-[4-cyclobutyl-3-(cyclobutylmethyl)-1-methylpyrazol-5-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
|---|---|
| PubChem CID | 172633731 |
| Molecular Formula | C19H25F4N3O |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-[4-cyclobutyl-3-(cyclobutylmethyl)-1-methylpyrazol-5-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
| SMILES | Cn1nc(CC2CCC2)c(C2CCC2)c1NC(=O)C[C@@H]1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C19H25F4N3O/c1-26-17(24-15(27)9-13-10-18(20,21)19(13,22)23)16(12-6-3-7-12)14(25-26)8-11-4-2-5-11/h11-13H,2-10H2,1H3,(H,24,27)/t13-/m1/s1 |
| InChIKey | JDQKJTRYZCUADY-CYBMUJFWSA-N |
| XLogP | 4.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|