C37H40F5N3O2Si — CID 174060387
N-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-cyclobutyl-3-(4-fluorophenyl)pyrazol-5-yl]-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide (PubChem CID 174060387) has the molecular formula C37H40F5N3O2Si and a molecular weight of 681.82 g/mol. Its IUPAC name is N-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-cyclobutyl-3-(4-fluorophenyl)pyrazol-5-yl]-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide.
| Compound Name | N-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-cyclobutyl-3-(4-fluorophenyl)pyrazol-5-yl]-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide |
|---|---|
| PubChem CID | 174060387 |
| Molecular Formula | C37H40F5N3O2Si |
| Molecular Weight | 681.82 g/mol |
| Exact Mass | 681.28 |
| IUPAC Name | N-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-cyclobutyl-3-(4-fluorophenyl)pyrazol-5-yl]-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide |
| SMILES | CC(C)(C)[Si](OCCn1nc(-c2ccc(F)cc2)c(C2CCC2)c1NC(=O)CC1CC(F)(F)C1(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H40F5N3O2Si/c1-35(2,3)48(29-13-6-4-7-14-29,30-15-8-5-9-16-30)47-22-21-45-34(43-31(46)23-27-24-36(39,40)37(27,41)42)32(25-11-10-12-25)33(44-45)26-17-19-28(38)20-18-26/h4-9,13-20,25,27H,10-12,21-24H2,1-3H3,(H,43,46) |
| InChIKey | AHMMXMIYNHVHQA-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.82 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|