C22H22F7N3O2 — CID 172633900
N-[4-cyclobutyl-1-methyl-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazol-5-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide (PubChem CID 172633900) has the molecular formula C22H22F7N3O2 and a molecular weight of 493.42 g/mol. Its IUPAC name is N-[4-cyclobutyl-1-methyl-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazol-5-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide.
| Compound Name | N-[4-cyclobutyl-1-methyl-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazol-5-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
|---|---|
| PubChem CID | 172633900 |
| Molecular Formula | C22H22F7N3O2 |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-[4-cyclobutyl-1-methyl-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazol-5-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
| SMILES | Cn1nc(-c2ccc(OCC(F)(F)F)cc2)c(C2CCC2)c1NC(=O)C[C@H]1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C22H22F7N3O2/c1-32-19(30-16(33)9-14-10-20(23,24)22(14,28)29)17(12-3-2-4-12)18(31-32)13-5-7-15(8-6-13)34-11-21(25,26)27/h5-8,12,14H,2-4,9-11H2,1H3,(H,30,33)/t14-/m0/s1 |
| InChIKey | JVBKZICUQICMTE-AWEZNQCLSA-N |
| XLogP | 5.91 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|