C18H22F4N4O — CID 157256627
N-(3-cyclobutyl-5-methylimidazo[4,5-b]pyridin-2-yl)-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide;methane (PubChem CID 157256627) has the molecular formula C18H22F4N4O and a molecular weight of 386.39 g/mol. Its IUPAC name is N-(3-cyclobutyl-5-methylimidazo[4,5-b]pyridin-2-yl)-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide;methane.
| Compound Name | N-(3-cyclobutyl-5-methylimidazo[4,5-b]pyridin-2-yl)-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide;methane |
|---|---|
| PubChem CID | 157256627 |
| Molecular Formula | C18H22F4N4O |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-(3-cyclobutyl-5-methylimidazo[4,5-b]pyridin-2-yl)-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide;methane |
| SMILES | C.Cc1ccc2nc(NC(=O)CC3CC(F)(F)C3(F)F)n(C3CCC3)c2n1 |
| InChI | InChI=1S/C17H18F4N4O.CH4/c1-9-5-6-12-14(22-9)25(11-3-2-4-11)15(23-12)24-13(26)7-10-8-16(18,19)17(10,20)21;/h5-6,10-11H,2-4,7-8H2,1H3,(H,23,24,26);1H4 |
| InChIKey | AWYUOUDQFYLJRB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|