C16H17ClF2N4O — CID 118692440
N-(5-chloro-3-cyclobutylimidazo[4,5-b]pyridin-2-yl)-2-(3,3-difluorocyclobutyl)acetamide (PubChem CID 118692440) has the molecular formula C16H17ClF2N4O and a molecular weight of 354.79 g/mol. Its IUPAC name is N-(5-chloro-3-cyclobutylimidazo[4,5-b]pyridin-2-yl)-2-(3,3-difluorocyclobutyl)acetamide.
| Compound Name | N-(5-chloro-3-cyclobutylimidazo[4,5-b]pyridin-2-yl)-2-(3,3-difluorocyclobutyl)acetamide |
|---|---|
| PubChem CID | 118692440 |
| Molecular Formula | C16H17ClF2N4O |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-(5-chloro-3-cyclobutylimidazo[4,5-b]pyridin-2-yl)-2-(3,3-difluorocyclobutyl)acetamide |
| SMILES | O=C(CC1CC(F)(F)C1)Nc1nc2ccc(Cl)nc2n1C1CCC1 |
| InChI | InChI=1S/C16H17ClF2N4O/c17-12-5-4-11-14(21-12)23(10-2-1-3-10)15(20-11)22-13(24)6-9-7-16(18,19)8-9/h4-5,9-10H,1-3,6-8H2,(H,20,22,24) |
| InChIKey | ONZOFSXMXOBLQY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|