C17H22F2N4O — CID 137393183
1-[(3-cyclobutyl-5-methylimidazo[4,5-b]pyridin-2-yl)amino]-2-(3,3-difluorocyclobutyl)ethanol (PubChem CID 137393183) has the molecular formula C17H22F2N4O and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-[(3-cyclobutyl-5-methylimidazo[4,5-b]pyridin-2-yl)amino]-2-(3,3-difluorocyclobutyl)ethanol.
| Compound Name | 1-[(3-cyclobutyl-5-methylimidazo[4,5-b]pyridin-2-yl)amino]-2-(3,3-difluorocyclobutyl)ethanol |
|---|---|
| PubChem CID | 137393183 |
| Molecular Formula | C17H22F2N4O |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[(3-cyclobutyl-5-methylimidazo[4,5-b]pyridin-2-yl)amino]-2-(3,3-difluorocyclobutyl)ethanol |
| SMILES | Cc1ccc2nc(NC(O)CC3CC(F)(F)C3)n(C3CCC3)c2n1 |
| InChI | InChI=1S/C17H22F2N4O/c1-10-5-6-13-15(20-10)23(12-3-2-4-12)16(21-13)22-14(24)7-11-8-17(18,19)9-11/h5-6,11-12,14,24H,2-4,7-9H2,1H3,(H,21,22) |
| InChIKey | NTKABWHAQXQFTN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|