C21H20F4N4O2 — CID 172633578
N-[5-(1,2-benzoxazol-3-yl)-4-cyclobutyl-1-methylpyrazol-3-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide (PubChem CID 172633578) has the molecular formula C21H20F4N4O2 and a molecular weight of 436.41 g/mol. Its IUPAC name is N-[5-(1,2-benzoxazol-3-yl)-4-cyclobutyl-1-methylpyrazol-3-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide.
| Compound Name | N-[5-(1,2-benzoxazol-3-yl)-4-cyclobutyl-1-methylpyrazol-3-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
|---|---|
| PubChem CID | 172633578 |
| Molecular Formula | C21H20F4N4O2 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[5-(1,2-benzoxazol-3-yl)-4-cyclobutyl-1-methylpyrazol-3-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
| SMILES | Cn1nc(NC(=O)C[C@H]2CC(F)(F)C2(F)F)c(C2CCC2)c1-c1noc2ccccc12 |
| InChI | InChI=1S/C21H20F4N4O2/c1-29-18(17-13-7-2-3-8-14(13)31-28-17)16(11-5-4-6-11)19(27-29)26-15(30)9-12-10-20(22,23)21(12,24)25/h2-3,7-8,11-12H,4-6,9-10H2,1H3,(H,26,27,30)/t12-/m0/s1 |
| InChIKey | LSELKXPTOOINPE-LBPRGKRZSA-N |
| XLogP | 5.11 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|