C19H27F4N3O — CID 172633865
N-[4-cyclobutyl-3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide (PubChem CID 172633865) has the molecular formula C19H27F4N3O and a molecular weight of 389.44 g/mol. Its IUPAC name is N-[4-cyclobutyl-3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide.
| Compound Name | N-[4-cyclobutyl-3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
|---|---|
| PubChem CID | 172633865 |
| Molecular Formula | C19H27F4N3O |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[4-cyclobutyl-3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
| SMILES | Cn1nc(CC(C)(C)C)c(C2CCC2)c1NC(=O)C[C@H]1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C19H27F4N3O/c1-17(2,3)10-13-15(11-6-5-7-11)16(26(4)25-13)24-14(27)8-12-9-18(20,21)19(12,22)23/h11-12H,5-10H2,1-4H3,(H,24,27)/t12-/m0/s1 |
| InChIKey | MGORNULDAVTJCF-LBPRGKRZSA-N |
| XLogP | 4.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|