C18H23F4N3O — CID 172633724
N-[4-cyclobutyl-3-(cyclopropylmethyl)-1-methylpyrazol-5-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide (PubChem CID 172633724) has the molecular formula C18H23F4N3O and a molecular weight of 373.39 g/mol. Its IUPAC name is N-[4-cyclobutyl-3-(cyclopropylmethyl)-1-methylpyrazol-5-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide.
| Compound Name | N-[4-cyclobutyl-3-(cyclopropylmethyl)-1-methylpyrazol-5-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
|---|---|
| PubChem CID | 172633724 |
| Molecular Formula | C18H23F4N3O |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[4-cyclobutyl-3-(cyclopropylmethyl)-1-methylpyrazol-5-yl]-2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
| SMILES | Cn1nc(CC2CC2)c(C2CCC2)c1NC(=O)C[C@@H]1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C18H23F4N3O/c1-25-16(23-14(26)8-12-9-17(19,20)18(12,21)22)15(11-3-2-4-11)13(24-25)7-10-5-6-10/h10-12H,2-9H2,1H3,(H,23,26)/t12-/m1/s1 |
| InChIKey | PKAXBZXYDYXGJX-GFCCVEGCSA-N |
| XLogP | 4.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|