C16H14N4 — CID 172634504
2-[(2-methylphenyl)methylamino]-1H-benzimidazole-4-carbonitrile (PubChem CID 172634504) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-[(2-methylphenyl)methylamino]-1H-benzimidazole-4-carbonitrile.
| Compound Name | 2-[(2-methylphenyl)methylamino]-1H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 172634504 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-[(2-methylphenyl)methylamino]-1H-benzimidazole-4-carbonitrile |
| SMILES | Cc1ccccc1CNc1nc2c(C#N)cccc2[nH]1 |
| InChI | InChI=1S/C16H14N4/c1-11-5-2-3-6-13(11)10-18-16-19-14-8-4-7-12(9-17)15(14)20-16/h2-8H,10H2,1H3,(H2,18,19,20) |
| InChIKey | OONPEBMGEWXLFE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |