C29H23N5O2 — CID 172634467
4-[[(4-cyano-1H-benzimidazol-2-yl)amino]methyl]-N-[(4-phenoxyphenyl)methyl]benzamide (PubChem CID 172634467) has the molecular formula C29H23N5O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 4-[[(4-cyano-1H-benzimidazol-2-yl)amino]methyl]-N-[(4-phenoxyphenyl)methyl]benzamide.
| Compound Name | 4-[[(4-cyano-1H-benzimidazol-2-yl)amino]methyl]-N-[(4-phenoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 172634467 |
| Molecular Formula | C29H23N5O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 4-[[(4-cyano-1H-benzimidazol-2-yl)amino]methyl]-N-[(4-phenoxyphenyl)methyl]benzamide |
| SMILES | N#Cc1cccc2[nH]c(NCc3ccc(C(=O)NCc4ccc(Oc5ccccc5)cc4)cc3)nc12 |
| InChI | InChI=1S/C29H23N5O2/c30-17-23-5-4-8-26-27(23)34-29(33-26)32-19-20-9-13-22(14-10-20)28(35)31-18-21-11-15-25(16-12-21)36-24-6-2-1-3-7-24/h1-16H,18-19H2,(H,31,35)(H2,32,33,34) |
| InChIKey | YLTSVDMZBLAHGE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 102.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |