C24H31FO3Si — CID 172634640
CID 172634640 (PubChem CID 172634640) has the molecular formula C24H31FO3Si and a molecular weight of 414.59 g/mol.
| Compound Name | CID 172634640 |
|---|---|
| PubChem CID | 172634640 |
| Molecular Formula | C24H31FO3Si |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | — |
| SMILES | COCOc1cc(O)c2c(C#C[Si]C(C(C)C)(C(C)C)C(C)C)c(F)ccc2c1 |
| InChI | InChI=1S/C24H31FO3Si/c1-15(2)24(16(3)4,17(5)6)29-11-10-20-21(25)9-8-18-12-19(28-14-27-7)13-22(26)23(18)20/h8-9,12-13,15-17,26H,14H2,1-7H3 |
| InChIKey | CNASEHWIFDXTQO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|