C22H28ClFO4 — CID 175816022
2-[8-chloro-2-fluoro-6-(methoxymethoxy)naphthalen-1-yl]ethyl 3-ethylhexanoate (PubChem CID 175816022) has the molecular formula C22H28ClFO4 and a molecular weight of 410.91 g/mol. Its IUPAC name is 2-[8-chloro-2-fluoro-6-(methoxymethoxy)naphthalen-1-yl]ethyl 3-ethylhexanoate.
| Compound Name | 2-[8-chloro-2-fluoro-6-(methoxymethoxy)naphthalen-1-yl]ethyl 3-ethylhexanoate |
|---|---|
| PubChem CID | 175816022 |
| Molecular Formula | C22H28ClFO4 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[8-chloro-2-fluoro-6-(methoxymethoxy)naphthalen-1-yl]ethyl 3-ethylhexanoate |
| SMILES | CCCC(CC)CC(=O)OCCc1c(F)ccc2cc(OCOC)cc(Cl)c12 |
| InChI | InChI=1S/C22H28ClFO4/c1-4-6-15(5-2)11-21(25)27-10-9-18-20(24)8-7-16-12-17(28-14-26-3)13-19(23)22(16)18/h7-8,12-13,15H,4-6,9-11,14H2,1-3H3 |
| InChIKey | CNKCBBLRPUAAQM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|