C20H29FO3Si — CID 171613475
tert-butyl-[2-[2-fluoro-6-(methoxymethoxy)naphthalen-1-yl]ethoxy]-dimethylsilane (PubChem CID 171613475) has the molecular formula C20H29FO3Si and a molecular weight of 364.53 g/mol. Its IUPAC name is tert-butyl-[2-[2-fluoro-6-(methoxymethoxy)naphthalen-1-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[2-fluoro-6-(methoxymethoxy)naphthalen-1-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 171613475 |
| Molecular Formula | C20H29FO3Si |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | tert-butyl-[2-[2-fluoro-6-(methoxymethoxy)naphthalen-1-yl]ethoxy]-dimethylsilane |
| SMILES | COCOc1ccc2c(CCO[Si](C)(C)C(C)(C)C)c(F)ccc2c1 |
| InChI | InChI=1S/C20H29FO3Si/c1-20(2,3)25(5,6)24-12-11-18-17-9-8-16(23-14-22-4)13-15(17)7-10-19(18)21/h7-10,13H,11-12,14H2,1-6H3 |
| InChIKey | HFSMYGAXKSOOMJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|