C24H31BF2O6 — CID 171613204
ethyl 2-fluoro-4-[2-fluoro-6-(methoxymethoxy)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate (PubChem CID 171613204) has the molecular formula C24H31BF2O6 and a molecular weight of 464.31 g/mol. Its IUPAC name is ethyl 2-fluoro-4-[2-fluoro-6-(methoxymethoxy)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate.
| Compound Name | ethyl 2-fluoro-4-[2-fluoro-6-(methoxymethoxy)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate |
|---|---|
| PubChem CID | 171613204 |
| Molecular Formula | C24H31BF2O6 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | ethyl 2-fluoro-4-[2-fluoro-6-(methoxymethoxy)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate |
| SMILES | CCOC(=O)C(F)CCc1c(F)ccc2cc(OCOC)cc(B3OC(C)(C)C(C)(C)O3)c12 |
| InChI | InChI=1S/C24H31BF2O6/c1-7-30-22(28)20(27)11-9-17-19(26)10-8-15-12-16(31-14-29-6)13-18(21(15)17)25-32-23(2,3)24(4,5)33-25/h8,10,12-13,20H,7,9,11,14H2,1-6H3 |
| InChIKey | VPELQOHAFWXLOS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|