C18H26BClO4 — CID 167381067
2-[3-chloro-5-(methoxymethoxy)-2-[(1S,2R)-2-methylcyclopropyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 167381067) has the molecular formula C18H26BClO4 and a molecular weight of 352.67 g/mol. Its IUPAC name is 2-[3-chloro-5-(methoxymethoxy)-2-[(1S,2R)-2-methylcyclopropyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-chloro-5-(methoxymethoxy)-2-[(1S,2R)-2-methylcyclopropyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 167381067 |
| Molecular Formula | C18H26BClO4 |
| Molecular Weight | 352.67 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[3-chloro-5-(methoxymethoxy)-2-[(1S,2R)-2-methylcyclopropyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COCOc1cc(Cl)c([C@H]2C[C@H]2C)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C18H26BClO4/c1-11-7-13(11)16-14(8-12(9-15(16)20)22-10-21-6)19-23-17(2,3)18(4,5)24-19/h8-9,11,13H,7,10H2,1-6H3/t11-,13+/m1/s1 |
| InChIKey | UFFZDILRUIYYPK-YPMHNXCESA-N |
| XLogP | 3.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.67 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|