C13H10ClFN4O — CID 172635974
2-chloro-7-[(4-fluorophenyl)methyl]-9-methylpurin-8-one (PubChem CID 172635974) has the molecular formula C13H10ClFN4O and a molecular weight of 292.70 g/mol. Its IUPAC name is 2-chloro-7-[(4-fluorophenyl)methyl]-9-methylpurin-8-one.
| Compound Name | 2-chloro-7-[(4-fluorophenyl)methyl]-9-methylpurin-8-one |
|---|---|
| PubChem CID | 172635974 |
| Molecular Formula | C13H10ClFN4O |
| Molecular Weight | 292.70 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-chloro-7-[(4-fluorophenyl)methyl]-9-methylpurin-8-one |
| SMILES | Cn1c(=O)n(Cc2ccc(F)cc2)c2cnc(Cl)nc21 |
| InChI | InChI=1S/C13H10ClFN4O/c1-18-11-10(6-16-12(14)17-11)19(13(18)20)7-8-2-4-9(15)5-3-8/h2-6H,7H2,1H3 |
| InChIKey | GNALVBJBXYBBGR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |