C20H28N2O — CID 172637256
3-[[4-[(3R)-pyrrolidin-3-yl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one (PubChem CID 172637256) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 3-[[4-[(3R)-pyrrolidin-3-yl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one.
| Compound Name | 3-[[4-[(3R)-pyrrolidin-3-yl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 172637256 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 3-[[4-[(3R)-pyrrolidin-3-yl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
| SMILES | O=C1NC2CCCCC2CC1Cc1ccc([C@H]2CCNC2)cc1 |
| InChI | InChI=1S/C20H28N2O/c23-20-18(12-16-3-1-2-4-19(16)22-20)11-14-5-7-15(8-6-14)17-9-10-21-13-17/h5-8,16-19,21H,1-4,9-13H2,(H,22,23)/t16?,17-,18?,19?/m0/s1 |
| InChIKey | PMRACCCOGWLURO-JRVPFXOQSA-N |
| XLogP | 3.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |