C20H40OSi — CID 172639663
tert-butyl-dimethyl-(4-pentylnona-2,3-dienoxy)silane (PubChem CID 172639663) has the molecular formula C20H40OSi and a molecular weight of 324.63 g/mol. Its IUPAC name is tert-butyl-dimethyl-(4-pentylnona-2,3-dienoxy)silane.
| Compound Name | tert-butyl-dimethyl-(4-pentylnona-2,3-dienoxy)silane |
|---|---|
| PubChem CID | 172639663 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | tert-butyl-dimethyl-(4-pentylnona-2,3-dienoxy)silane |
| SMILES | CCCCCC(=C=CCO[Si](C)(C)C(C)(C)C)CCCCC |
| InChI | InChI=1S/C20H40OSi/c1-8-10-12-15-19(16-13-11-9-2)17-14-18-21-22(6,7)20(3,4)5/h14H,8-13,15-16,18H2,1-7H3 |
| InChIKey | QUFNAZLDUGYUDH-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|