C26H38O8 — CID 172642084
(3S,4R,6R)-6-[[(3S,5S,10S,13S)-10,13-dimethyl-1-methylidene-17-oxo-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-2H-cyclopenta[a]phenanthren-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 172642084) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is (3S,4R,6R)-6-[[(3S,5S,10S,13S)-10,13-dimethyl-1-methylidene-17-oxo-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-2H-cyclopenta[a]phenanthren-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3S,4R,6R)-6-[[(3S,5S,10S,13S)-10,13-dimethyl-1-methylidene-17-oxo-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-2H-cyclopenta[a]phenanthren-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 172642084 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (3S,4R,6R)-6-[[(3S,5S,10S,13S)-10,13-dimethyl-1-methylidene-17-oxo-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-2H-cyclopenta[a]phenanthren-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | C=C1C[C@@H](O[C@@H]2OC(C(=O)O)[C@@H](O)[C@@H](O)C2O)C[C@@H]2CCC3C4CCC(=O)[C@@]4(C)CCC3[C@@]12C |
| InChI | InChI=1S/C26H38O8/c1-12-10-14(33-24-21(30)19(28)20(29)22(34-24)23(31)32)11-13-4-5-15-16-6-7-18(27)25(16,2)9-8-17(15)26(12,13)3/h13-17,19-22,24,28-30H,1,4-11H2,2-3H3,(H,31,32)/t13-,14+,15?,16?,17?,19+,20-,21?,22?,24+,25-,26-/m0/s1 |
| InChIKey | NEROJAIFUVJKBJ-NDPQKFNMSA-N |
| XLogP | 2.04 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|