C21H30O — CID 87191294
(8R,9S,10S,13S,14S)-10,13-dimethyl-1,2-dimethylidene-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 87191294) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-10,13-dimethyl-1,2-dimethylidene-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10S,13S,14S)-10,13-dimethyl-1,2-dimethylidene-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 87191294 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (8R,9S,10S,13S,14S)-10,13-dimethyl-1,2-dimethylidene-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C=C1CCC2CC[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@@]2(C)C1=C |
| InChI | InChI=1S/C21H30O/c1-13-5-6-15-7-8-16-17-9-10-19(22)20(17,3)12-11-18(16)21(15,4)14(13)2/h15-18H,1-2,5-12H2,3-4H3/t15?,16-,17-,18-,20-,21-/m0/s1 |
| InChIKey | WMQQQNIGDRVSPY-QCDWPJGMSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |