C21H30O2 — CID 69133308
(1E,8R,9S,10S,13S,14S)-1-ethylidene-10,13-dimethyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 69133308) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (1E,8R,9S,10S,13S,14S)-1-ethylidene-10,13-dimethyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (1E,8R,9S,10S,13S,14S)-1-ethylidene-10,13-dimethyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 69133308 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (1E,8R,9S,10S,13S,14S)-1-ethylidene-10,13-dimethyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C/C=C1\CC(=O)CC2CC[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@@]12C |
| InChI | InChI=1S/C21H30O2/c1-4-13-11-15(22)12-14-5-6-16-17-7-8-19(23)20(17,2)10-9-18(16)21(13,14)3/h4,14,16-18H,5-12H2,1-3H3/b13-4+/t14?,16-,17-,18-,20-,21-/m0/s1 |
| InChIKey | JOPCWAHHTVWQBA-JMAFNVKOSA-N |
| XLogP | 4.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|