C17H20ClF2N — CID 172643222
3-(8-chloro-1,1-difluorooct-1-en-2-yl)-1-methylindole (PubChem CID 172643222) has the molecular formula C17H20ClF2N and a molecular weight of 311.80 g/mol. Its IUPAC name is 3-(8-chloro-1,1-difluorooct-1-en-2-yl)-1-methylindole.
| Compound Name | 3-(8-chloro-1,1-difluorooct-1-en-2-yl)-1-methylindole |
|---|---|
| PubChem CID | 172643222 |
| Molecular Formula | C17H20ClF2N |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-(8-chloro-1,1-difluorooct-1-en-2-yl)-1-methylindole |
| SMILES | Cn1cc(C(CCCCCCCl)=C(F)F)c2ccccc21 |
| InChI | InChI=1S/C17H20ClF2N/c1-21-12-15(13-8-5-6-10-16(13)21)14(17(19)20)9-4-2-3-7-11-18/h5-6,8,10,12H,2-4,7,9,11H2,1H3 |
| InChIKey | CLYANDJWUDUQOQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|