C17H19F2NO2 — CID 23020206
(6,6-difluoro-5-methylhex-5-enyl) 1-methylindole-3-carboxylate (PubChem CID 23020206) has the molecular formula C17H19F2NO2 and a molecular weight of 307.34 g/mol. Its IUPAC name is (6,6-difluoro-5-methylhex-5-enyl) 1-methylindole-3-carboxylate.
| Compound Name | (6,6-difluoro-5-methylhex-5-enyl) 1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 23020206 |
| Molecular Formula | C17H19F2NO2 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (6,6-difluoro-5-methylhex-5-enyl) 1-methylindole-3-carboxylate |
| SMILES | CC(CCCCOC(=O)c1cn(C)c2ccccc12)=C(F)F |
| InChI | InChI=1S/C17H19F2NO2/c1-12(16(18)19)7-5-6-10-22-17(21)14-11-20(2)15-9-4-3-8-13(14)15/h3-4,8-9,11H,5-7,10H2,1-2H3 |
| InChIKey | GCQGXTYNHYVSFK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|