C12H16F2N2O2 — CID 69180848
(6,6-difluoro-5-methylhex-5-enyl) 1-methylimidazole-4-carboxylate (PubChem CID 69180848) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is (6,6-difluoro-5-methylhex-5-enyl) 1-methylimidazole-4-carboxylate.
| Compound Name | (6,6-difluoro-5-methylhex-5-enyl) 1-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 69180848 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (6,6-difluoro-5-methylhex-5-enyl) 1-methylimidazole-4-carboxylate |
| SMILES | CC(CCCCOC(=O)c1cn(C)cn1)=C(F)F |
| InChI | InChI=1S/C12H16F2N2O2/c1-9(11(13)14)5-3-4-6-18-12(17)10-7-16(2)8-15-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | WNBOKBUQSQAXQY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|