C12H21F2NO2S4 — CID 87843753
(8,8-difluoro-7-methyloct-7-enyl) N,N-bis(methyldisulfanyl)carbamate (PubChem CID 87843753) has the molecular formula C12H21F2NO2S4 and a molecular weight of 377.57 g/mol. Its IUPAC name is (8,8-difluoro-7-methyloct-7-enyl) N,N-bis(methyldisulfanyl)carbamate.
| Compound Name | (8,8-difluoro-7-methyloct-7-enyl) N,N-bis(methyldisulfanyl)carbamate |
|---|---|
| PubChem CID | 87843753 |
| Molecular Formula | C12H21F2NO2S4 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (8,8-difluoro-7-methyloct-7-enyl) N,N-bis(methyldisulfanyl)carbamate |
| SMILES | CSSN(SSC)C(=O)OCCCCCCC(C)=C(F)F |
| InChI | InChI=1S/C12H21F2NO2S4/c1-10(11(13)14)8-6-4-5-7-9-17-12(16)15(20-18-2)21-19-3/h4-9H2,1-3H3 |
| InChIKey | WPFLCSMGIIMRLB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|