C15H15F2NO2S — CID 69180259
(6,6-difluoro-5-methylhex-5-enyl) 1,2-benzothiazole-3-carboxylate (PubChem CID 69180259) has the molecular formula C15H15F2NO2S and a molecular weight of 311.35 g/mol. Its IUPAC name is (6,6-difluoro-5-methylhex-5-enyl) 1,2-benzothiazole-3-carboxylate.
| Compound Name | (6,6-difluoro-5-methylhex-5-enyl) 1,2-benzothiazole-3-carboxylate |
|---|---|
| PubChem CID | 69180259 |
| Molecular Formula | C15H15F2NO2S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (6,6-difluoro-5-methylhex-5-enyl) 1,2-benzothiazole-3-carboxylate |
| SMILES | CC(CCCCOC(=O)c1nsc2ccccc12)=C(F)F |
| InChI | InChI=1S/C15H15F2NO2S/c1-10(14(16)17)6-4-5-9-20-15(19)13-11-7-2-3-8-12(11)21-18-13/h2-3,7-8H,4-6,9H2,1H3 |
| InChIKey | KXJWLYOHIZKIGL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|