C15H20BF2NO2 — CID 172644973
4-(2,2-difluoro-1-methylcyclopropyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 172644973) has the molecular formula C15H20BF2NO2 and a molecular weight of 295.14 g/mol. Its IUPAC name is 4-(2,2-difluoro-1-methylcyclopropyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 4-(2,2-difluoro-1-methylcyclopropyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 172644973 |
| Molecular Formula | C15H20BF2NO2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-(2,2-difluoro-1-methylcyclopropyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2cc(C3(C)CC3(F)F)ccn2)OC1(C)C |
| InChI | InChI=1S/C15H20BF2NO2/c1-12(2)13(3,4)21-16(20-12)11-8-10(6-7-19-11)14(5)9-15(14,17)18/h6-8H,9H2,1-5H3 |
| InChIKey | LMUGIUOIPPRIAW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|