C22H24ClN2O5PS — CID 172645872
5-(3,4-dimethoxyphenyl)-3-dimethoxyphosphoryl-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine;hydrochloride (PubChem CID 172645872) has the molecular formula C22H24ClN2O5PS and a molecular weight of 494.94 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-3-dimethoxyphosphoryl-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine;hydrochloride.
| Compound Name | 5-(3,4-dimethoxyphenyl)-3-dimethoxyphosphoryl-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 172645872 |
| Molecular Formula | C22H24ClN2O5PS |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-3-dimethoxyphosphoryl-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine;hydrochloride |
| SMILES | COc1ccc(C2C=C(c3ccccc3)N=C3SC=C(P(=O)(OC)OC)N32)cc1OC.Cl |
| InChI | InChI=1S/C22H23N2O5PS.ClH/c1-26-19-11-10-16(12-20(19)27-2)18-13-17(15-8-6-5-7-9-15)23-22-24(18)21(14-31-22)30(25,28-3)29-4;/h5-14,18H,1-4H3;1H |
| InChIKey | SETMNYPDKOPSQV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|