C14H16BrF2NO — CID 172648531
(5-bromo-2,4-difluorophenyl)-(4,4-dimethylpiperidin-1-yl)methanone (PubChem CID 172648531) has the molecular formula C14H16BrF2NO and a molecular weight of 332.19 g/mol. Its IUPAC name is (5-bromo-2,4-difluorophenyl)-(4,4-dimethylpiperidin-1-yl)methanone.
| Compound Name | (5-bromo-2,4-difluorophenyl)-(4,4-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 172648531 |
| Molecular Formula | C14H16BrF2NO |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (5-bromo-2,4-difluorophenyl)-(4,4-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1(C)CCN(C(=O)c2cc(Br)c(F)cc2F)CC1 |
| InChI | InChI=1S/C14H16BrF2NO/c1-14(2)3-5-18(6-4-14)13(19)9-7-10(15)12(17)8-11(9)16/h7-8H,3-6H2,1-2H3 |
| InChIKey | PDRZTYKXAPGNPT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|