C19H18O2S — CID 172650116
[3-(4-methylthiophen-2-yl)-5-phenylmethoxyphenyl]methanol (PubChem CID 172650116) has the molecular formula C19H18O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is [3-(4-methylthiophen-2-yl)-5-phenylmethoxyphenyl]methanol.
| Compound Name | [3-(4-methylthiophen-2-yl)-5-phenylmethoxyphenyl]methanol |
|---|---|
| PubChem CID | 172650116 |
| Molecular Formula | C19H18O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [3-(4-methylthiophen-2-yl)-5-phenylmethoxyphenyl]methanol |
| SMILES | Cc1csc(-c2cc(CO)cc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C19H18O2S/c1-14-7-19(22-13-14)17-8-16(11-20)9-18(10-17)21-12-15-5-3-2-4-6-15/h2-10,13,20H,11-12H2,1H3 |
| InChIKey | CXMHCAFNXMMZBF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |