C25H21N5O4 — CID 172653609
N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]acetamide (PubChem CID 172653609) has the molecular formula C25H21N5O4 and a molecular weight of 455.47 g/mol. Its IUPAC name is N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 172653609 |
| Molecular Formula | C25H21N5O4 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]acetamide |
| SMILES | COc1ccc(-c2nc3ccccc3n2CC(=O)/N=N/c2c(O)[nH]c3ccc(OC)cc23)cc1 |
| InChI | InChI=1S/C25H21N5O4/c1-33-16-9-7-15(8-10-16)24-26-20-5-3-4-6-21(20)30(24)14-22(31)28-29-23-18-13-17(34-2)11-12-19(18)27-25(23)32/h3-13,27,32H,14H2,1-2H3/b29-28+ |
| InChIKey | GSBGSXCPAYHCJT-ZQHSETAFSA-N |
| XLogP | 5.22 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|