C24H23N3O6S — CID 172653636
6-methoxy-3-[2-[(2E)-2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 172653636) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is 6-methoxy-3-[2-[(2E)-2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 6-methoxy-3-[2-[(2E)-2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 172653636 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 6-methoxy-3-[2-[(2E)-2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | COc1ccc2oc(=O)c(-c3csc(N/N=C(\C)c4cc(OC)c(OC)c(OC)c4)n3)cc2c1 |
| InChI | InChI=1S/C24H23N3O6S/c1-13(14-10-20(30-3)22(32-5)21(11-14)31-4)26-27-24-25-18(12-34-24)17-9-15-8-16(29-2)6-7-19(15)33-23(17)28/h6-12H,1-5H3,(H,25,27)/b26-13+ |
| InChIKey | JHQUHSXGORNVFK-LGJNPRDNSA-N |
| XLogP | 4.79 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|