C21H23FN2O4 — CID 172657136
3-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carbonyl]-1-(4-fluorophenyl)-4-methylpyridin-2-one (PubChem CID 172657136) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is 3-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carbonyl]-1-(4-fluorophenyl)-4-methylpyridin-2-one.
| Compound Name | 3-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carbonyl]-1-(4-fluorophenyl)-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 172657136 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carbonyl]-1-(4-fluorophenyl)-4-methylpyridin-2-one |
| SMILES | Cc1ccn(-c2ccc(F)cc2)c(=O)c1C(=O)N1C[C@@H]2CCOC[C@]2(CO)C1 |
| InChI | InChI=1S/C21H23FN2O4/c1-14-6-8-24(17-4-2-16(22)3-5-17)20(27)18(14)19(26)23-10-15-7-9-28-13-21(15,11-23)12-25/h2-6,8,15,25H,7,9-13H2,1H3/t15-,21+/m0/s1 |
| InChIKey | OIDFYDHOUXIXKT-YCRPNKLZSA-N |
| XLogP | 1.76 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |